Products 941294-52-6

CAS 941294-52-6 is the registry number for 1-(Benzyloxy)-4-bromo-2,3-difluorobenzene, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 100g, 1g.

Structural formula: {0} (CAS {1})

1-bromo-2,3-difluoro-4-phenylmethoxybenzene (CAS 941294-52-6) is a chemical compound with the molecular formula C13H9BrF2O and a molecular weight of 299.11 g/mol. IUPAC name: 1-bromo-2,3-difluoro-4-phenylmethoxybenzene. InChIKey: SOVXEAXNAFZMRB-UHFFFAOYSA-N.

Identity
Molecular formulaC13H9BrF2O
Molecular weight299.11 g/mol
IUPAC name1-bromo-2,3-difluoro-4-phenylmethoxybenzene
InChIKeySOVXEAXNAFZMRB-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC2=C(C(=C(C=C2)Br)F)F

Computed by PubChem (NCBI)