CAS 941294-52-6 is the registry number for 1-(Benzyloxy)-4-bromo-2,3-difluorobenzene, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 100g, 1g.
1-bromo-2,3-difluoro-4-phenylmethoxybenzene (CAS 941294-52-6) is a chemical compound with the molecular formula C13H9BrF2O and a molecular weight of 299.11 g/mol. IUPAC name: 1-bromo-2,3-difluoro-4-phenylmethoxybenzene. InChIKey: SOVXEAXNAFZMRB-UHFFFAOYSA-N.
| Molecular formula | C13H9BrF2O |
|---|---|
| Molecular weight | 299.11 g/mol |
| IUPAC name | 1-bromo-2,3-difluoro-4-phenylmethoxybenzene |
| InChIKey | SOVXEAXNAFZMRB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C(=C(C=C2)Br)F)F |
Computed by PubChem (NCBI)