cas: 206560-66-9 — see every product listed under this CAS number, including other names
1-Bromo-4-(pentafluoroethyl)benzene (CAS 206560-66-9) is a chemical reagent available from Chemat. Available pack sizes: 2,5g, 250mg, 50mg, 1g, 5g. Offered by: Biosynth, Fluorochem.
| brand | Biosynth |
|---|---|
| catalog number | GIA56066-2,5g |
| cas | 206560-66-9 |
| size | 2,5g |
| brand | size | price | |
|---|---|---|---|
| Biosynth | 2,5g | price on request | |
| Biosynth | 250mg | price on request | |
| Fluorochem | 50mg | 799.74 Pln | |
| Fluorochem | 250mg | 1226.67 Pln | |
| Fluorochem | 1g | 2018.06 Pln | |
| Fluorochem | 5g | 5954.17 Pln |
| category | Research Chemicals |
|---|---|
| sub-category 1 | Building Blocks |
| purity | No data |
| delivery time | 3-4 weeks |
1-bromo-4-(1,1,2,2,2-pentafluoroethyl)benzene (CAS 206560-66-9) is a chemical compound with the molecular formula C8H4BrF5 and a molecular weight of 275.01 g/mol. IUPAC name: 1-bromo-4-(1,1,2,2,2-pentafluoroethyl)benzene. InChIKey: PVBVOTISXJPMFC-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF5 |
|---|---|
| Molecular weight | 275.01 g/mol |
| IUPAC name | 1-bromo-4-(1,1,2,2,2-pentafluoroethyl)benzene |
| InChIKey | PVBVOTISXJPMFC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(F)(F)F)(F)F)Br |
Computed by PubChem (NCBI)