cas: 118664-99-6 — see every product listed under this CAS number, including other names
1-Chloro-2-fluoro-4-methyl-5-nitrobenzene 97% (CAS 118664-99-6) is a chemical reagent available from Chemat. Available pack sizes: 500g, 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A160183-500g |
| cas | 118664-99-6 |
| size | 500g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 5916.19 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 25g | 476.06 Pln | |
| Ambeed | 100g | 1532.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A160183 |
1-chloro-2-fluoro-4-methyl-5-nitrobenzene (CAS 118664-99-6) is a chemical compound with the molecular formula C7H5ClFNO2 and a molecular weight of 189.57 g/mol. IUPAC name: 1-chloro-2-fluoro-4-methyl-5-nitrobenzene. InChIKey: WZEMBGOGKOKTDW-UHFFFAOYSA-N.
| Molecular formula | C7H5ClFNO2 |
|---|---|
| Molecular weight | 189.57 g/mol |
| IUPAC name | 1-chloro-2-fluoro-4-methyl-5-nitrobenzene |
| InChIKey | WZEMBGOGKOKTDW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1[N+](=O)[O-])Cl)F |
Computed by PubChem (NCBI)