cas: 101623-69-2 — see every product listed under this CAS number, including other names
1-Chloroethyl (4-nitrophenyl) carbonate, 97%, 97% (CAS 101623-69-2) is a chemical reagent available from Chemat. Available pack sizes: 50g, 250g, 1kg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11161A-50g |
| cas | 101623-69-2 |
| size | 50g |
| availability | 2000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 237.20 Pln | |
| Chemat | 250g | 842.00 Pln | |
| Chemat | 1kg | 2800.40 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 10g | 107.60 Pln | |
| Chemat | 25g | 150.80 Pln | |
| Chemat | 100g | 405.20 Pln | |
| Chemat | 500g | 1526.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-chloroethyl (4-nitrophenyl) carbonate (CAS 101623-69-2) is a chemical compound with the molecular formula C9H8ClNO5 and a molecular weight of 245.61 g/mol. IUPAC name: 1-chloroethyl (4-nitrophenyl) carbonate. InChIKey: DXVQFTPXVZUWIF-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO5 |
|---|---|
| Molecular weight | 245.61 g/mol |
| IUPAC name | 1-chloroethyl (4-nitrophenyl) carbonate |
| InChIKey | DXVQFTPXVZUWIF-UHFFFAOYSA-N |
| SMILES | CC(OC(=O)OC1=CC=C(C=C1)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)