Products 2750929-19-0
CAS 2750929-19-0 is the registry number for 3-Chloro-6-methoxy-5-(methoxycarbonyl)picolinic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-chloro-6-methoxy-5-methoxycarbonylpyridine-2-carboxylic acid (CAS 2750929-19-0) is a chemical compound with the molecular formula C9H8ClNO5 and a molecular weight of 245.61 g/mol. IUPAC name: 3-chloro-6-methoxy-5-methoxycarbonylpyridine-2-carboxylic acid. InChIKey: DAXCXPJNPQDTAQ-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO5 |
|---|---|
| Molecular weight | 245.61 g/mol |
| IUPAC name | 3-chloro-6-methoxy-5-methoxycarbonylpyridine-2-carboxylic acid |
| InChIKey | DAXCXPJNPQDTAQ-UHFFFAOYSA-N |
| SMILES | COC1=NC(=C(C=C1C(=O)OC)Cl)C(=O)O |
Computed by PubChem (NCBI)