CAS 90537-46-5 appears in our catalog under these names: 2-Chloro-4-methoxy-5-nitro-benzoic acid methyl ester, 98%, Methyl 2-chloro-4-methoxy-5-nitrobenzoate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g, 250mg.
Methyl 2-chloro-4-methoxy-5-nitrobenzoate (CAS 90537-46-5) is a chemical compound with the molecular formula C9H8ClNO5 and a molecular weight of 245.61 g/mol. IUPAC name: methyl 2-chloro-4-methoxy-5-nitrobenzoate. InChIKey: CTRKTHJHCFTDHI-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO5 |
|---|---|
| Molecular weight | 245.61 g/mol |
| IUPAC name | methyl 2-chloro-4-methoxy-5-nitrobenzoate |
| InChIKey | CTRKTHJHCFTDHI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)Cl)C(=O)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)