CAS 669758-45-6 is the registry number for Methyl (2-chloro-6-nitrophenoxy)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 2-(2-chloro-6-nitrophenoxy)acetate (CAS 669758-45-6) is a chemical compound with the molecular formula C9H8ClNO5 and a molecular weight of 245.61 g/mol. IUPAC name: methyl 2-(2-chloro-6-nitrophenoxy)acetate. InChIKey: KUYRANCDCIREER-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO5 |
|---|---|
| Molecular weight | 245.61 g/mol |
| IUPAC name | methyl 2-(2-chloro-6-nitrophenoxy)acetate |
| InChIKey | KUYRANCDCIREER-UHFFFAOYSA-N |
| SMILES | COC(=O)COC1=C(C=CC=C1Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)