Products 465532-43-8
CAS 465532-43-8 is the registry number for 2,5-Dimethoxy-4-nitrobenzoyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,5-dimethoxy-4-nitrobenzoyl chloride (CAS 465532-43-8) is a chemical compound with the molecular formula C9H8ClNO5 and a molecular weight of 245.61 g/mol. IUPAC name: 2,5-dimethoxy-4-nitrobenzoyl chloride. InChIKey: WERIKRCDCABNKU-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO5 |
|---|---|
| Molecular weight | 245.61 g/mol |
| IUPAC name | 2,5-dimethoxy-4-nitrobenzoyl chloride |
| InChIKey | WERIKRCDCABNKU-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C(=O)Cl)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
2,5-Dimethoxy-4-nitrobenzoyl chloride