Products 1349744-88-2
CAS 1349744-88-2 appears in our catalog under these names: Methyl 2-chloro-5-methoxy-4-nitrobenzoate, 97%, 2-Chloro-5-methoxy-4-nitro-benzoic acid methyl ester, 98%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 1g.
Methyl 2-chloro-5-methoxy-4-nitrobenzoate (CAS 1349744-88-2) is a chemical compound with the molecular formula C9H8ClNO5 and a molecular weight of 245.61 g/mol. IUPAC name: methyl 2-chloro-5-methoxy-4-nitrobenzoate. InChIKey: VCVQUCAIJKTZQU-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO5 |
|---|---|
| Molecular weight | 245.61 g/mol |
| IUPAC name | methyl 2-chloro-5-methoxy-4-nitrobenzoate |
| InChIKey | VCVQUCAIJKTZQU-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(=O)OC)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)