Products 109069-75-2
CAS 109069-75-2 appears in our catalog under these names: Methyl 4-chloro-2-methoxy-5-nitrobenzoate, 4-Chloro-2-methoxy-5-nitro-benzoic acid methyl ester, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 2,5g, 5g, 25g, 10g, 1g.
Methyl 4-chloro-2-methoxy-5-nitrobenzoate (CAS 109069-75-2) is a chemical compound with the molecular formula C9H8ClNO5 and a molecular weight of 245.61 g/mol. IUPAC name: methyl 4-chloro-2-methoxy-5-nitrobenzoate. InChIKey: SPSVQVKAYOHSBJ-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO5 |
|---|---|
| Molecular weight | 245.61 g/mol |
| IUPAC name | methyl 4-chloro-2-methoxy-5-nitrobenzoate |
| InChIKey | SPSVQVKAYOHSBJ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C(=O)OC)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)