cas: 281192-95-8 — see every product listed under this CAS number, including other names
1-Ethyl-1H-pyrrolo[2,3-b]pyridine-2,3-dione, 95% (CAS 281192-95-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F772566-100MG |
| cas | 281192-95-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 643.54 Pln | |
| Fluorochem | 250mg | 1216.26 Pln | |
| Fluorochem | 1g | 3501.91 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
1-ethylpyrrolo[2,3-b]pyridine-2,3-dione (CAS 281192-95-8) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 1-ethylpyrrolo[2,3-b]pyridine-2,3-dione. InChIKey: KZNALZYBNJOBNB-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 1-ethylpyrrolo[2,3-b]pyridine-2,3-dione |
| InChIKey | KZNALZYBNJOBNB-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=CC=N2)C(=O)C1=O |
Computed by PubChem (NCBI)