CAS 871239-18-8 appears in our catalog under these names: 2-Amino-5-cyano-3-methylbenzoic acid, 95%, 2-Amino-5-cyano-3-methylbenzoicAcid, >95% (HPLC), 2-amino-5-cyano-3-methylbenzoic acid, 2-Amino-5-Cyano-3-Methylbenzoic Acid, 98%, 98%, 2-AMINO-5-CYANO-3-METHYLBENZOIC ACID, 98%. Offered by: Combi-blocks, TRC, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 500mg, 50mg, 10g, 100mg.
2-amino-5-cyano-3-methylbenzoic acid (CAS 871239-18-8) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 2-amino-5-cyano-3-methylbenzoic acid. InChIKey: FYPIIMYXBCWBPQ-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 2-amino-5-cyano-3-methylbenzoic acid |
| InChIKey | FYPIIMYXBCWBPQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1N)C(=O)O)C#N |
Computed by PubChem (NCBI)