CAS 1000545-78-7 is the registry number for 2-(1H-Pyrrolo[2,3-b]pyridin-5-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.
2-(1H-pyrrolo[2,3-b]pyridin-5-yl)acetic acid (CAS 1000545-78-7) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 2-(1H-pyrrolo[2,3-b]pyridin-5-yl)acetic acid. InChIKey: PXTUIYOFXJVDEL-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 2-(1H-pyrrolo[2,3-b]pyridin-5-yl)acetic acid |
| InChIKey | PXTUIYOFXJVDEL-UHFFFAOYSA-N |
| SMILES | C1=CNC2=NC=C(C=C21)CC(=O)O |
Computed by PubChem (NCBI)