CAS 53484-17-6 appears in our catalog under these names: 1-Methylbenzodiazole-5-carboxylic acid, 98%, 1-Methyl-1H-benzimidazole-5-carboxylic acid, 97% , 1-Methyl-1H-benzo[d]imidazole-5-carboxylic acid 98%, 1-Methyl-1H-benzo[d]imidazole-5-carboxylic acid, 98%, 98%, 1-Methyl-1H-benzimidazole-5-carboxylic acid, 98%. Offered by: Combi-blocks, Thermo Scientific, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 250MG, 100mg.
1-methylbenzimidazole-5-carboxylic acid (CAS 53484-17-6) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 1-methylbenzimidazole-5-carboxylic acid. InChIKey: KAJLCBKTWRUQOI-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 1-methylbenzimidazole-5-carboxylic acid |
| InChIKey | KAJLCBKTWRUQOI-UHFFFAOYSA-N |
| SMILES | CN1C=NC2=C1C=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)