CAS 850424-10-1 is the registry number for 2(1H)-Quinazolinone, 6-methoxy, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-methoxy-1H-quinazolin-2-one (CAS 850424-10-1) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 6-methoxy-1H-quinazolin-2-one. InChIKey: IUQPNHYCLQPISC-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 6-methoxy-1H-quinazolin-2-one |
| InChIKey | IUQPNHYCLQPISC-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)NC(=O)N=C2 |
Computed by PubChem (NCBI)