Products 858227-12-0
CAS 858227-12-0 appears in our catalog under these names: 6-Methyl-1h-indazole-3-carboxylic acid, 97%, 6–Methyl–1H–indazole–3–carboxylic acid, 6-Methyl-1H-indazole-3-carboxylic acid, 6-Methyl-1H-indazole-3-carboxylic acid, 98%, 98%, 6-Methyl-1H-indazole-3-carboxylic acid, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 0,5g, 500mg.
6-methyl-1H-indazole-3-carboxylic acid (CAS 858227-12-0) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 6-methyl-1H-indazole-3-carboxylic acid. InChIKey: PXMCNJOQYWBJDO-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 6-methyl-1H-indazole-3-carboxylic acid |
| InChIKey | PXMCNJOQYWBJDO-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=NN2)C(=O)O |
Computed by PubChem (NCBI)