CAS 281192-95-8 appears in our catalog under these names: N-ethyl-7-azaisatin, 95%, 95%, 1-Ethyl-1h,2h,3h-pyrrolo[2,3-b]pyridine-2,3-dione, 95%, 1–ethyl–1H,2H,3H–pyrrolo(2,3–b)pyridine–2,3–dione, 1-Ethyl-1H-pyrrolo[2,3-b]pyridine-2,3-dione, 95%. Offered by: Chemat, Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-ethylpyrrolo[2,3-b]pyridine-2,3-dione (CAS 281192-95-8) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 1-ethylpyrrolo[2,3-b]pyridine-2,3-dione. InChIKey: KZNALZYBNJOBNB-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 1-ethylpyrrolo[2,3-b]pyridine-2,3-dione |
| InChIKey | KZNALZYBNJOBNB-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=CC=N2)C(=O)C1=O |
Computed by PubChem (NCBI)