cas: 28141-13-1 — see every product listed under this CAS number, including other names
1-Ethyl-6-hydroxy-4-methyl-2-oxo-1,2-dihydropyridine-3-carbonitrile (CAS 28141-13-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch114EAG-1g |
| cas | 28141-13-1 |
| size | 1g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 131.60 Pln | |
| Chemat | 25g | 242.00 Pln | |
| Fluorochem | 5g | 206.20 Pln |
| delivery time | 3 weeks |
|---|
1-ethyl-2-hydroxy-4-methyl-6-oxopyridine-3-carbonitrile (CAS 28141-13-1) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: 1-ethyl-2-hydroxy-4-methyl-6-oxopyridine-3-carbonitrile. InChIKey: YSNMMQRIPFUHAO-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | 1-ethyl-2-hydroxy-4-methyl-6-oxopyridine-3-carbonitrile |
| InChIKey | YSNMMQRIPFUHAO-UHFFFAOYSA-N |
| SMILES | CCN1C(=O)C=C(C(=C1O)C#N)C |
Computed by PubChem (NCBI)