CAS 132522-83-9 appears in our catalog under these names: 5-Amino-4-methyl-3,4-dihydro-2h-1,4-benzoxazin-3-one, 95%, 5-Amino-4-methyl-3,4-dihydro-2H-1,4-benzoxazin-3-one, 95+%, 5-Amino-4-methyl-3,4-dihydro-2H-1,4-benzoxazin-3-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 100mg, 5g, 10g, 250mg, 1g, 0,5g.
5-amino-4-methyl-1,4-benzoxazin-3-one (CAS 132522-83-9) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: 5-amino-4-methyl-1,4-benzoxazin-3-one. InChIKey: WFBXYEPLEPAVMO-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | 5-amino-4-methyl-1,4-benzoxazin-3-one |
| InChIKey | WFBXYEPLEPAVMO-UHFFFAOYSA-N |
| SMILES | CN1C(=O)COC2=CC=CC(=C21)N |
Computed by PubChem (NCBI)