Products 639807-18-4
CAS 639807-18-4 appears in our catalog under these names: 2-Cyclopropylaminonicotinic acid, 97%, 2–(Cyclopropylamino)nicotinic acid, 2-(Cyclopropylamino)nicotinic acid 97%, 2-Cyclopropylaminonicotinic acid, 97%, 97%, 2-(Cyclopropylamino)nicotinic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 10g, 100g, 250mg.
2-(cyclopropylamino)pyridine-3-carboxylic acid (CAS 639807-18-4) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: 2-(cyclopropylamino)pyridine-3-carboxylic acid. InChIKey: QVDNJGOBMXAPSJ-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | 2-(cyclopropylamino)pyridine-3-carboxylic acid |
| InChIKey | QVDNJGOBMXAPSJ-UHFFFAOYSA-N |
| SMILES | C1CC1NC2=C(C=CC=N2)C(=O)O |
Computed by PubChem (NCBI)