Products 134704-32-8
CAS 134704-32-8 is the registry number for 2-(1,3-Benzoxazol-2-ylamino)ethanol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(1,3-benzoxazol-2-ylamino)ethanol (CAS 134704-32-8) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: 2-(1,3-benzoxazol-2-ylamino)ethanol. InChIKey: PPBNFUWGFXLQBB-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | 2-(1,3-benzoxazol-2-ylamino)ethanol |
| InChIKey | PPBNFUWGFXLQBB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(O2)NCCO |
Computed by PubChem (NCBI)