CAS 306936-07-2 appears in our catalog under these names: 2,3-Dihydrobenzo[b]furan-5-amide oxime, 95%, 2,3-Dihydrobenzo(b)furan-5-amidoxime. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 10g.
N'-hydroxy-2,3-dihydro-1-benzofuran-5-carboximidamide (CAS 306936-07-2) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: N'-hydroxy-2,3-dihydro-1-benzofuran-5-carboximidamide. InChIKey: KGLRLCNFJVSMCI-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | N'-hydroxy-2,3-dihydro-1-benzofuran-5-carboximidamide |
| InChIKey | KGLRLCNFJVSMCI-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C=C(C=C2)/C(=N/O)/N |
Computed by PubChem (NCBI)