Products 306936-07-2

CAS 306936-07-2 appears in our catalog under these names: 2,3-Dihydrobenzo[b]furan-5-amide oxime, 95%, 2,3-Dihydrobenzo(b)furan-5-amidoxime. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 10g.

Structural formula: {0} (CAS {1})

N'-hydroxy-2,3-dihydro-1-benzofuran-5-carboximidamide (CAS 306936-07-2) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: N'-hydroxy-2,3-dihydro-1-benzofuran-5-carboximidamide. InChIKey: KGLRLCNFJVSMCI-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10N2O2
Molecular weight178.19 g/mol
IUPAC nameN'-hydroxy-2,3-dihydro-1-benzofuran-5-carboximidamide
InChIKeyKGLRLCNFJVSMCI-UHFFFAOYSA-N
SMILESC1COC2=C1C=C(C=C2)/C(=N/O)/N

Computed by PubChem (NCBI)