CAS 1210455-01-8 appears in our catalog under these names: 6-Amino-8-methyl-2h-1,4-benzoxazin-3(4h)-one, 95%, 6-Amino-8-methyl-2h-1,4-benzoxazin-3(4h)-one hydrochloride, 95%, 6-Amino-8-methyl-2H-1,4-benzoxazin-3(4H)-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 100mg, 250mg, 500mg, 1000mg, 2000mg.
6-amino-8-methyl-4H-1,4-benzoxazin-3-one (CAS 1210455-01-8) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: 6-amino-8-methyl-4H-1,4-benzoxazin-3-one. InChIKey: DHVWELQEBVAAJQ-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | 6-amino-8-methyl-4H-1,4-benzoxazin-3-one |
| InChIKey | DHVWELQEBVAAJQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1OCC(=O)N2)N |
Computed by PubChem (NCBI)