CAS 18711-25-6 appears in our catalog under these names: 1-Methyl-5-nitroindoline, 98%, 1–Methyl–5–nitroindoline. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 5g, 1g, 100mg.
1-methyl-5-nitro-2,3-dihydroindole (CAS 18711-25-6) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: 1-methyl-5-nitro-2,3-dihydroindole. InChIKey: VNTWOKSFYDNPED-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | 1-methyl-5-nitro-2,3-dihydroindole |
| InChIKey | VNTWOKSFYDNPED-UHFFFAOYSA-N |
| SMILES | CN1CCC2=C1C=CC(=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)