cas: 1160790-84-0 — see every product listed under this CAS number, including other names
1-Methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2(1H)-one, 97% (CAS 1160790-84-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F465104-250MG |
| cas | 1160790-84-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 341.56 Pln | |
| Fluorochem | 500mg | 627.92 Pln | |
| Fluorochem | 1g | 700.81 Pln | |
| Fluorochem | 5g | 2361.69 Pln | |
| Fluorochem | 10g | 4043.39 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one (CAS 1160790-84-0) is a chemical compound with the molecular formula C12H18BNO3 and a molecular weight of 235.09 g/mol. IUPAC name: 1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one. InChIKey: AVJRGCKNVZTWQH-UHFFFAOYSA-N.
| Molecular formula | C12H18BNO3 |
|---|---|
| Molecular weight | 235.09 g/mol |
| IUPAC name | 1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one |
| InChIKey | AVJRGCKNVZTWQH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=O)N(C=C2)C |
Computed by PubChem (NCBI)