1-Methylindazole-7-carboxylic acid, 97%
cas: 1221288-23-8 — see every product listed under this CAS number, including other names
1-Methylindazole-7-carboxylic acid, 97% (CAS 1221288-23-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A797704-250mg |
| cas | 1221288-23-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 375.94 Pln | |
| Ambeed | 1g | 698.56 Pln | |
| Ambeed | 5g | 2278.31 Pln | |
| Ambeed | 10g | 4475.50 Pln | |
| Chemat | 100mg | 222.80 Pln | |
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 1g | 558.80 Pln | |
| Chemat | 5g | 1811.60 Pln | |
| BLDpharm | 100mg | 253.27 Pln | |
| BLDpharm | 250mg | 364.34 Pln | |
| BLDpharm | 1g | 680.90 Pln | |
| BLDpharm | 5g | 2419.17 Pln | |
| BLDpharm | 10g | 4762.79 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
1-methylindazole-7-carboxylic acid (CAS 1221288-23-8) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 1-methylindazole-7-carboxylic acid. InChIKey: APWKGIDYINRPKW-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 1-methylindazole-7-carboxylic acid |
| InChIKey | APWKGIDYINRPKW-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC=C2C(=O)O)C=N1 |
Computed by PubChem (NCBI)