cas: 173669-61-9 — see every product listed under this CAS number, including other names
1-Methylindoline-6-sulfonyl chloride, 97% (CAS 173669-61-9) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A578684-1g |
| cas | 173669-61-9 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 9887.08 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-methyl-2,3-dihydroindole-6-sulfonyl chloride (CAS 173669-61-9) is a chemical compound with the molecular formula C9H10ClNO2S and a molecular weight of 231.70 g/mol. IUPAC name: 1-methyl-2,3-dihydroindole-6-sulfonyl chloride. InChIKey: ORDYBOFQRJTHRV-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO2S |
|---|---|
| Molecular weight | 231.70 g/mol |
| IUPAC name | 1-methyl-2,3-dihydroindole-6-sulfonyl chloride |
| InChIKey | ORDYBOFQRJTHRV-UHFFFAOYSA-N |
| SMILES | CN1CCC2=C1C=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)