Products 71703-11-2
CAS 71703-11-2 is the registry number for N-(2-Chlorophenyl)-1,3-propanesultam, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 25g, 5g.
2-(2-chlorophenyl)-1,2-thiazolidine 1,1-dioxide (CAS 71703-11-2) is a chemical compound with the molecular formula C9H10ClNO2S and a molecular weight of 231.70 g/mol. IUPAC name: 2-(2-chlorophenyl)-1,2-thiazolidine 1,1-dioxide. InChIKey: WQYJDNBRTFGPHS-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO2S |
|---|---|
| Molecular weight | 231.70 g/mol |
| IUPAC name | 2-(2-chlorophenyl)-1,2-thiazolidine 1,1-dioxide |
| InChIKey | WQYJDNBRTFGPHS-UHFFFAOYSA-N |
| SMILES | C1CN(S(=O)(=O)C1)C2=CC=CC=C2Cl |
Computed by PubChem (NCBI)