CAS 886845-22-3 is the registry number for 3-((4-Chlorophenyl)amino)thietane 1,1-dioxide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(4-chlorophenyl)-1,1-dioxothietan-3-amine (CAS 886845-22-3) is a chemical compound with the molecular formula C9H10ClNO2S and a molecular weight of 231.70 g/mol. IUPAC name: N-(4-chlorophenyl)-1,1-dioxothietan-3-amine. InChIKey: WWIRBMXVJCPWIU-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO2S |
|---|---|
| Molecular weight | 231.70 g/mol |
| IUPAC name | N-(4-chlorophenyl)-1,1-dioxothietan-3-amine |
| InChIKey | WWIRBMXVJCPWIU-UHFFFAOYSA-N |
| SMILES | C1C(CS1(=O)=O)NC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)