CAS 354128-89-5 appears in our catalog under these names: 4-Chloro-N-cyclopropylbenzenesulfonamide, 98%, 4-Chloro-N-cyclopropylbenzenesulfonamide 98%, 4-Chloro-N-cyclopropylbenzenesulfonamide, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
4-chloro-N-cyclopropylbenzenesulfonamide (CAS 354128-89-5) is a chemical compound with the molecular formula C9H10ClNO2S and a molecular weight of 231.70 g/mol. IUPAC name: 4-chloro-N-cyclopropylbenzenesulfonamide. InChIKey: BAOROYZLWUOHLF-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO2S |
|---|---|
| Molecular weight | 231.70 g/mol |
| IUPAC name | 4-chloro-N-cyclopropylbenzenesulfonamide |
| InChIKey | BAOROYZLWUOHLF-UHFFFAOYSA-N |
| SMILES | C1CC1NS(=O)(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)