CAS 173669-61-9 appears in our catalog under these names: 1-Methyl-2,3-dihydro-1h-indole-6-sulfonyl chloride, 95%, 1-Methylindoline-6-sulfonyl chloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
1-methyl-2,3-dihydroindole-6-sulfonyl chloride (CAS 173669-61-9) is a chemical compound with the molecular formula C9H10ClNO2S and a molecular weight of 231.70 g/mol. IUPAC name: 1-methyl-2,3-dihydroindole-6-sulfonyl chloride. InChIKey: ORDYBOFQRJTHRV-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO2S |
|---|---|
| Molecular weight | 231.70 g/mol |
| IUPAC name | 1-methyl-2,3-dihydroindole-6-sulfonyl chloride |
| InChIKey | ORDYBOFQRJTHRV-UHFFFAOYSA-N |
| SMILES | CN1CCC2=C1C=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)