Products 870530-41-9
CAS 870530-41-9 is the registry number for 1-((4-Chlorophenyl)sulfonyl)azetidine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(4-chlorophenyl)sulfonylazetidine (CAS 870530-41-9) is a chemical compound with the molecular formula C9H10ClNO2S and a molecular weight of 231.70 g/mol. IUPAC name: 1-(4-chlorophenyl)sulfonylazetidine. InChIKey: DCQWHROLYADCSU-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO2S |
|---|---|
| Molecular weight | 231.70 g/mol |
| IUPAC name | 1-(4-chlorophenyl)sulfonylazetidine |
| InChIKey | DCQWHROLYADCSU-UHFFFAOYSA-N |
| SMILES | C1CN(C1)S(=O)(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)