CAS 71703-13-4 is the registry number for N-(4-Chlorophenyl)-1,3-propanesultam, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
2-(4-chlorophenyl)-1,2-thiazolidine 1,1-dioxide (CAS 71703-13-4) is a chemical compound with the molecular formula C9H10ClNO2S and a molecular weight of 231.70 g/mol. IUPAC name: 2-(4-chlorophenyl)-1,2-thiazolidine 1,1-dioxide. InChIKey: ZCMOUUAHRSJJOR-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO2S |
|---|---|
| Molecular weight | 231.70 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-1,2-thiazolidine 1,1-dioxide |
| InChIKey | ZCMOUUAHRSJJOR-UHFFFAOYSA-N |
| SMILES | C1CN(S(=O)(=O)C1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)