cas: 885951-89-3 — see every product listed under this CAS number, including other names
1-N-FMOC-PYRROLIDINE-3-CARBOXYLIC ACID, 95% (CAS 885951-89-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F334003-100MG |
| cas | 885951-89-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 565.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-3-carboxylic acid (CAS 885951-89-3) is a chemical compound with the molecular formula C20H19NO4 and a molecular weight of 337.4 g/mol. IUPAC name: 1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-3-carboxylic acid. InChIKey: GUAMYYOQAAUXLR-UHFFFAOYSA-N.
| Molecular formula | C20H19NO4 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | 1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-3-carboxylic acid |
| InChIKey | GUAMYYOQAAUXLR-UHFFFAOYSA-N |
| SMILES | C1CN(CC1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)