Fmoc-DL-β-Pro-OH, 95%, 95%
cas: 885951-89-3 — see every product listed under this CAS number, including other names
Fmoc-DL-β-Pro-OH, 95%, 95% (CAS 885951-89-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115CW4-100mg |
| cas | 885951-89-3 |
| size | 100mg |
| availability | 20g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 357.20 Pln | |
| Chemat | 250mg | 549.20 Pln | |
| Chemat | 1g | 1043.60 Pln | |
| Chemat | 5g | 4806.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-3-carboxylic acid (CAS 885951-89-3) is a chemical compound with the molecular formula C20H19NO4 and a molecular weight of 337.4 g/mol. IUPAC name: 1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-3-carboxylic acid. InChIKey: GUAMYYOQAAUXLR-UHFFFAOYSA-N.
| Molecular formula | C20H19NO4 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | 1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-3-carboxylic acid |
| InChIKey | GUAMYYOQAAUXLR-UHFFFAOYSA-N |
| SMILES | C1CN(CC1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)
Synonyms:
1-(((9H-fluoren-9-yl)methoxy)carbonyl)pyrrolidine-3-carboxylic acid, Fmoc-1-pyrrolidine-3-carboxylic acid, Fmoc-DL-beta-Pro-OH, 1-Fmoc-3-pyrrolidinecarboxylic acid, 1-Fmoc-Pyrrolidine-3-carboxylic acid, 1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-3-carboxylic Acid, Fmoc-|?-Pro-OH, Fmoc-DL-|A-Pro-OH, Fmoc-DL-|_-Pro-OH