cas: 3079-53-6 — see every product listed under this CAS number, including other names
1-Nitro-2-propoxybenzene, 95-<97% (CAS 3079-53-6) is a chemical reagent available from Chemat. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC4601-95-97-25g |
| cas | 3079-53-6 |
| size | 25g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 25g | 6413.66 Pln | |
| Hoffman Fine Chemicals | 50g | 10075.78 Pln | |
| Hoffman Fine Chemicals | 100g | 15932.62 Pln | |
| Hoffman Fine Chemicals | 200g | 25311.22 Pln | |
| Hoffman Fine Chemicals | 300g | 32188.86 Pln | |
| Hoffman Fine Chemicals | 400g | 36437.94 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
1-nitro-2-propoxybenzene (CAS 3079-53-6) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 1-nitro-2-propoxybenzene. InChIKey: IGIBTRWOXSIMMM-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 1-nitro-2-propoxybenzene |
| InChIKey | IGIBTRWOXSIMMM-UHFFFAOYSA-N |
| SMILES | CCCOC1=CC=CC=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)