cas: 620-88-2 — see every product listed under this CAS number, including other names
1-Nitro-4-phenoxybenzene, 98% (CAS 620-88-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 250g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F336977-5G |
| cas | 620-88-2 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 133.30 Pln | |
| Fluorochem | 25g | 232.23 Pln | |
| Fluorochem | 100g | 575.86 Pln | |
| Fluorochem | 250g | 1356.83 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-nitro-4-phenoxybenzene (CAS 620-88-2) is a chemical compound with the molecular formula C12H9NO3 and a molecular weight of 215.20 g/mol. IUPAC name: 1-nitro-4-phenoxybenzene. InChIKey: JDTMUJBWSGNMGR-UHFFFAOYSA-N.
| Molecular formula | C12H9NO3 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | 1-nitro-4-phenoxybenzene |
| InChIKey | JDTMUJBWSGNMGR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)