1-Oxa-6-azaspiro[3.3]heptane oxalate(2:1), 97%
cas: 1523606-38-3 — see every product listed under this CAS number, including other names
1-Oxa-6-azaspiro[3.3]heptane oxalate(2:1), 97% (CAS 1523606-38-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A648465-100mg |
| cas | 1523606-38-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 770.88 Pln | |
| Ambeed | 250mg | 1182.50 Pln | |
| Ambeed | 1g | 2968.06 Pln | |
| Ambeed | 5g | 8908.81 Pln | |
| Chemat | 100mg | 654.80 Pln | |
| Chemat | 250mg | 1010.00 Pln | |
| Chemat | 1g | 2522.00 Pln | |
| Chemat | 5g | 7720.40 Pln | |
| BLDpharm | 100mg | 753.09 Pln | |
| BLDpharm | 250mg | 1158.51 Pln | |
| BLDpharm | 1g | 2913.44 Pln | |
| BLDpharm | 5g | 8733.62 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Bis(1-oxa-6-azaspiro[3.3]heptane);oxalic acid (CAS 1523606-38-3) is a chemical compound with the molecular formula C12H20N2O6 and a molecular weight of 288.30 g/mol. IUPAC name: bis(1-oxa-6-azaspiro[3.3]heptane);oxalic acid. InChIKey: NQWVKVADDRLOQM-UHFFFAOYSA-N.
| Molecular formula | C12H20N2O6 |
|---|---|
| Molecular weight | 288.30 g/mol |
| IUPAC name | bis(1-oxa-6-azaspiro[3.3]heptane);oxalic acid |
| InChIKey | NQWVKVADDRLOQM-UHFFFAOYSA-N |
| SMILES | C1COC12CNC2.C1COC12CNC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)