Products 1394319-56-2
CAS 1394319-56-2 appears in our catalog under these names: 1-Boc-1,6-diazaspiro[3.3]heptane oxalate, 96%, tert-Butyl 1,6-diazaspiro(3.3)heptane-1-carboxylate oxalate, 97%, 1–Boc–1，6–diazaspiro(3·3)heptane oxalate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g.
Tert-butyl 1,6-diazaspiro[3.3]heptane-1-carboxylate;oxalic acid (CAS 1394319-56-2) is a chemical compound with the molecular formula C12H20N2O6 and a molecular weight of 288.30 g/mol. IUPAC name: tert-butyl 1,6-diazaspiro[3.3]heptane-1-carboxylate;oxalic acid. InChIKey: MAQNAKFABGFATB-UHFFFAOYSA-N.
| Molecular formula | C12H20N2O6 |
|---|---|
| Molecular weight | 288.30 g/mol |
| IUPAC name | tert-butyl 1,6-diazaspiro[3.3]heptane-1-carboxylate;oxalic acid |
| InChIKey | MAQNAKFABGFATB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC12CNC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)