Products 1523530-74-6
CAS 1523530-74-6 appears in our catalog under these names: (1R,4R)-2-Oxa-5-azabicyclo[2.2.1]heptane hemioxalate, 95%, (1R,4R)-2-Oxa-5-azabicyclo(2.2.1)heptane oxalate(2:1), 95+%, (1R,4R)-2-Oxa-5-azabicyclo(2.2.1)heptane hemioxalate ee. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 1g, 0,5g, 10g.
Bis((1R,4R)-2-oxa-5-azabicyclo[2.2.1]heptane);oxalic acid (CAS 1523530-74-6) is a chemical compound with the molecular formula C12H20N2O6 and a molecular weight of 288.30 g/mol. IUPAC name: bis((1R,4R)-2-oxa-5-azabicyclo[2.2.1]heptane);oxalic acid. InChIKey: YNSNAVAMSHBSLQ-KKXFCUFMSA-N.
| Molecular formula | C12H20N2O6 |
|---|---|
| Molecular weight | 288.30 g/mol |
| IUPAC name | bis((1R,4R)-2-oxa-5-azabicyclo[2.2.1]heptane);oxalic acid |
| InChIKey | YNSNAVAMSHBSLQ-KKXFCUFMSA-N |
| SMILES | C1[C@@H]2CN[C@H]1CO2.C1[C@@H]2CN[C@H]1CO2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)