CAS 1359656-86-2 appears in our catalog under these names: oxalic acid, tert-butyl 1,6-diazaspiro(3.3)heptane-6-carboxylate, tert-Butyl 1,6-diazaspiro[3.3]heptane-6-carboxylate oxalate, 95%, 95%, tert-Butyl 1,6-diazaspiro[3.3]heptane-6-carboxylate oxalate, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 5g, 250mg.
Tert-butyl 1,6-diazaspiro[3.3]heptane-6-carboxylate;oxalic acid (CAS 1359656-86-2) is a chemical compound with the molecular formula C12H20N2O6 and a molecular weight of 288.30 g/mol. IUPAC name: tert-butyl 1,6-diazaspiro[3.3]heptane-6-carboxylate;oxalic acid. InChIKey: IZYLGQHHBZJYNW-UHFFFAOYSA-N.
| Molecular formula | C12H20N2O6 |
|---|---|
| Molecular weight | 288.30 g/mol |
| IUPAC name | tert-butyl 1,6-diazaspiro[3.3]heptane-6-carboxylate;oxalic acid |
| InChIKey | IZYLGQHHBZJYNW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CCN2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)