Products 1045709-32-7
CAS 1045709-32-7 appears in our catalog under these names: 2-Oxa-6-azaspiro[3.3]heptane oxalate (2:1) 97%, 2-Oxa-6-azaspiro[3.3]heptane oxalate（2:1）, 97%, 97%, 2-Oxa-6-azaspiro[3.3]heptane oxalate (2:1), 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g.
Bis(2-oxa-6-azaspiro[3.3]heptane);oxalic acid (CAS 1045709-32-7) is a chemical compound with the molecular formula C12H20N2O6 and a molecular weight of 288.30 g/mol. IUPAC name: bis(2-oxa-6-azaspiro[3.3]heptane);oxalic acid. InChIKey: RXBYDYSXIHJXNO-UHFFFAOYSA-N.
| Molecular formula | C12H20N2O6 |
|---|---|
| Molecular weight | 288.30 g/mol |
| IUPAC name | bis(2-oxa-6-azaspiro[3.3]heptane);oxalic acid |
| InChIKey | RXBYDYSXIHJXNO-UHFFFAOYSA-N |
| SMILES | C1C2(CN1)COC2.C1C2(CN1)COC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
2-oxa-6-azaspiro[3.3]heptane hemioxalate, 2-Oxa-6-azaspiro(3.3)heptane hemioxalate, bis(2-oxa-6-azaspiro[3.3]heptane) oxalate, 2-oxa-6-azaspiro[3.3]heptane hemioxalate salt, 2-oxa-6-azoniaspiro[3.3]heptane oxalate salt, bis(2-oxa-6-azaspiro[3.3]heptane); oxalic acid, 2-oxa, 2-Oxa-6-azaspiro[3.3]heptane semioxalate, 2-oxa-6-azonia-spiro[3.3]heptane oxalate salt