Products 1227382-01-5

CAS 1227382-01-5 appears in our catalog under these names: tert-Butyl 2,6-diazaspiro[3.3]heptane-2-carboxylate oxalate, 98%, 98%, tert-Butyl 2,6-diazaspiro[3.3]heptane-2-carboxylate oxalate, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100g, 100mg, 250mg, 1g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

Tert-butyl 2,6-diazaspiro[3.3]heptane-2-carboxylate;oxalic acid (CAS 1227382-01-5) is a chemical compound with the molecular formula C12H20N2O6 and a molecular weight of 288.30 g/mol. IUPAC name: tert-butyl 2,6-diazaspiro[3.3]heptane-2-carboxylate;oxalic acid. InChIKey: UMRJVCJJEKXMNB-UHFFFAOYSA-N.

Identity
Molecular formulaC12H20N2O6
Molecular weight288.30 g/mol
IUPAC nametert-butyl 2,6-diazaspiro[3.3]heptane-2-carboxylate;oxalic acid
InChIKeyUMRJVCJJEKXMNB-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CC2(C1)CNC2.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)