CAS 1523541-76-5 is the registry number for (1S,4S)-2-Oxa-5-azabicyclo[2.2.1]heptane hemioxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
Bis((1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptane);oxalic acid (CAS 1523541-76-5) is a chemical compound with the molecular formula C12H20N2O6 and a molecular weight of 288.30 g/mol. IUPAC name: bis((1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptane);oxalic acid. InChIKey: YNSNAVAMSHBSLQ-WFGSYIHQSA-N.
| Molecular formula | C12H20N2O6 |
|---|---|
| Molecular weight | 288.30 g/mol |
| IUPAC name | bis((1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptane);oxalic acid |
| InChIKey | YNSNAVAMSHBSLQ-WFGSYIHQSA-N |
| SMILES | C1[C@H]2CN[C@@H]1CO2.C1[C@H]2CN[C@@H]1CO2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)