cas: 3634-89-7 — see every product listed under this CAS number, including other names
1-Tosylaziridine 98% (CAS 3634-89-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A461485-250mg |
| cas | 3634-89-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 164.56 Pln | |
| Ambeed | 5g | 470.50 Pln | |
| Ambeed | 25g | 1538.50 Pln | |
| Ambeed | 100g | 4764.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A461485 |
1-(4-methylphenyl)sulfonylaziridine (CAS 3634-89-7) is a chemical compound with the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonylaziridine. InChIKey: VBNWSEVVMYMVLC-UHFFFAOYSA-N.
| Molecular formula | C9H11NO2S |
|---|---|
| Molecular weight | 197.26 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonylaziridine |
| InChIKey | VBNWSEVVMYMVLC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CC2 |
Computed by PubChem (NCBI)