cas: 112257-60-0 — see every product listed under this CAS number, including other names
1-Tritylpiperidin-4-One, 97%, 97% (CAS 112257-60-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119UA5-100mg |
| cas | 112257-60-0 |
| size | 100mg |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 261.20 Pln | |
| Chemat | 10g | 376.40 Pln | |
| Chemat | 25g | 640.40 Pln | |
| Chemat | 100g | 1682.00 Pln | |
| Chemat | 50g | 1029.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-tritylpiperidin-4-one (CAS 112257-60-0) is a chemical compound with the molecular formula C24H23NO and a molecular weight of 341.4 g/mol. IUPAC name: 1-tritylpiperidin-4-one. InChIKey: TTWLMWSWSQUXDB-UHFFFAOYSA-N.
| Molecular formula | C24H23NO |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | 1-tritylpiperidin-4-one |
| InChIKey | TTWLMWSWSQUXDB-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1=O)C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)