Products 1358118-35-0
CAS 1358118-35-0 appears in our catalog under these names: JWH 018 N–(1,1–dimethylpropyl) isomer, JWH 018 N-(1,1-dimethylpropyl) isomer. Offered by: GLPBio, Biosynth. Available pack sizes: 1mg, 10mg, 5mg, 25mg, 50mg.
[1-(2-methylbutan-2-yl)indol-3-yl]-naphthalen-1-ylmethanone (CAS 1358118-35-0) is a chemical compound with the molecular formula C24H23NO and a molecular weight of 341.4 g/mol. IUPAC name: [1-(2-methylbutan-2-yl)indol-3-yl]-naphthalen-1-ylmethanone. InChIKey: RAHXKESFWHOCTB-UHFFFAOYSA-N.
| Molecular formula | C24H23NO |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | [1-(2-methylbutan-2-yl)indol-3-yl]-naphthalen-1-ylmethanone |
| InChIKey | RAHXKESFWHOCTB-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)N1C=C(C2=CC=CC=C21)C(=O)C3=CC=CC4=CC=CC=C43 |
Computed by PubChem (NCBI)