CAS 2748469-65-8 is the registry number for JWH 016–d9. Offered by: GLPBio. Available pack sizes: 1mg, 5mg, 500μg.
[2-methyl-1-(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)indol-3-yl]-naphthalen-1-ylmethanone (CAS 2748469-65-8) is a chemical compound with the molecular formula C24H23NO and a molecular weight of 350.5 g/mol. IUPAC name: [2-methyl-1-(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)indol-3-yl]-naphthalen-1-ylmethanone. InChIKey: QKXRHYJSCZFHEK-SNQOLCNBSA-N.
| Molecular formula | C24H23NO |
|---|---|
| Molecular weight | 350.5 g/mol |
| IUPAC name | [2-methyl-1-(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)indol-3-yl]-naphthalen-1-ylmethanone |
| InChIKey | QKXRHYJSCZFHEK-SNQOLCNBSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])N1C(=C(C2=CC=CC=C21)C(=O)C3=CC=CC4=CC=CC=C43)C |
Computed by PubChem (NCBI)