Products 1869954-38-0
CAS 1869954-38-0 appears in our catalog under these names: JWH 018 2'–naphthyl–N–(2,2–dimethylpropyl) isomer, (1-(2,2-Dimethylpropyl)indol-3-yl)-naphthalen-2-ylmethanone. Offered by: GLPBio, Biosynth. Available pack sizes: 1mg, 10mg, 5mg, 50mg, 25mg.
[1-(2,2-dimethylpropyl)indol-3-yl]-naphthalen-2-ylmethanone (CAS 1869954-38-0) is a chemical compound with the molecular formula C24H23NO and a molecular weight of 341.4 g/mol. IUPAC name: [1-(2,2-dimethylpropyl)indol-3-yl]-naphthalen-2-ylmethanone. InChIKey: VAWLMOLQJCGJAZ-UHFFFAOYSA-N.
| Molecular formula | C24H23NO |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | [1-(2,2-dimethylpropyl)indol-3-yl]-naphthalen-2-ylmethanone |
| InChIKey | VAWLMOLQJCGJAZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CN1C=C(C2=CC=CC=C21)C(=O)C3=CC4=CC=CC=C4C=C3 |
Computed by PubChem (NCBI)