Products 1427325-40-3
CAS 1427325-40-3 appears in our catalog under these names: (1-(3-Methylbutan-2-yl)indol-3-yl)-naphthalen-1-ylmethanone, JWH 018 N–(1,2–dimethylpropyl) isomer. Offered by: Biosynth, GLPBio. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 1mg.
[1-(3-methylbutan-2-yl)indol-3-yl]-naphthalen-1-ylmethanone (CAS 1427325-40-3) is a chemical compound with the molecular formula C24H23NO and a molecular weight of 341.4 g/mol. IUPAC name: [1-(3-methylbutan-2-yl)indol-3-yl]-naphthalen-1-ylmethanone. InChIKey: JERJAAHYNIGGSX-UHFFFAOYSA-N.
| Molecular formula | C24H23NO |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | [1-(3-methylbutan-2-yl)indol-3-yl]-naphthalen-1-ylmethanone |
| InChIKey | JERJAAHYNIGGSX-UHFFFAOYSA-N |
| SMILES | CC(C)C(C)N1C=C(C2=CC=CC=C21)C(=O)C3=CC=CC4=CC=CC=C43 |
Computed by PubChem (NCBI)